CAS 66621-73-6
:2-Pyrimidineacetic acid
Description:
2-Pyrimidineacetic acid, with the CAS number 66621-73-6, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carboxylic acid functional group (-COOH) attached to the pyrimidine ring, specifically at the 2-position, which contributes to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. 2-Pyrimidineacetic acid may exhibit biological activity, making it of interest in pharmaceutical research and development. Its derivatives can potentially serve as intermediates in the synthesis of various bioactive compounds. Additionally, the compound's structure allows for various chemical modifications, which can enhance its properties or biological activity. As with many organic acids, it may participate in acid-base reactions and can form salts or esters under appropriate conditions.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c9-6(10)4-5-7-2-1-3-8-5/h1-3H,4H2,(H,9,10)
SMILES:c1cnc(CC(=O)O)nc1
Synonyms:- Pyrimidin-2-ylacetic acid
- Sodium 2-(Pyrimidin-2-Yl)Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Pyrimidineacetic acid
CAS:2-Pyrimidineacetic acid
Purity:95%Color and Shape:Off-White PowderMolecular weight:138.12g/mol2-Pyrimidineacetic Acid
CAS:Controlled ProductStability Unstable in Solution
Applications 2-Pyrimidineacetic acid is a reagent that is used in the preparation of pyrimidine derivatives for treating and or preventing sexual dysfunction.
References Huang, Z., Faming Zhuanli Shenqing, 2012:400114Formula:C6H6N2O2Color and Shape:NeatMolecular weight:138.12



