CAS 66630-72-6

2-phenyl-1H-benzimidazole-4-carboxylic acid

Description:

2-Phenyl-1H-benzimidazole-4-carboxylic acid is an organic compound characterized by its benzimidazole core, which features a phenyl group and a carboxylic acid functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of the carboxylic acid group contributes to its acidic nature, allowing it to participate in various chemical reactions, including esterification and amidation. The benzimidazole structure is known for its biological activity, often serving as a scaffold in pharmaceuticals, particularly in the development of anti-cancer and anti-inflammatory agents. Additionally, the phenyl substituent can influence the compound's electronic properties and reactivity. Overall, 2-phenyl-1H-benzimidazole-4-carboxylic acid is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₁₄H₁₀N₂O₂

InChI: InChI=1S/C14H10N2O2/c17-14(18)10-7-4-8-11-12(10)16-13(15-11)9-5-2-1-3-6-9/h1-8H,(H,15,16)(H,17,18)

InChI key: InChIKey=LZGYSXDYTDCYCR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(N=C(N2)C3=CC=CC=C3)=CC=C1

Synonyms:

• 1H-benzimidazole-4-carboxylic acid, 2-phenyl-
• 1H-benzimidazole-7-carboxylic acid, 2-phenyl-
• 2-Phenyl-1H-1,3-benzodiazole-4-carboxylic acid
• 2-Phenyl-1H-1,3-benzodiazole-7-carboxylic acid
• 2-Phenyl-1H-benzimidazole-7-carboxylic acid
• 2-Phenyl-3H-benzoimidazole-4-carboxylic acid
• 2-Phenylbenzimidazole-4-carboxylic acid
• 2-Phenyl-1H-benzimidazole-4-carboxylic acid

2-Phenyl-1H-benzimidazole-7-carboxylic acid

CAS: 66630-72-6

2-Phenyl-1H-benzimidazole-7-carboxylic acid

Formula: C₁₄H₁₀N₂O₂

Purity: 95%

Color and Shape: beige powder

Molecular weight: 238.24g/mol

Ref: 54-OR01760

2-Phenyl-1H-benzimidazole-7-carboxylic acid

CAS: 66630-72-6

2-Phenyl-1H-benzimidazole-7-carboxylic acid is a heterocyclic compound that has been shown to have antiviral and antiparasitic properties. It is an analog of benzimidazole, which is a lead compound for the development of new drugs for the treatment of viral diseases, such as coxsackievirus B3. This drug also has antiinflammatory properties and is documented to inhibit Coxsackie virus in cell culture.

Formula: C₁₄H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 238.24 g/mol

Ref: 3D-RCA63072