CAS 66635-85-6
:Anirolac
Description:
Anirolac, identified by the CAS number 66635-85-6, is a chemical compound that belongs to the class of substances known as aromatic amines. It is characterized by its specific molecular structure, which typically includes an aromatic ring and an amine functional group. This compound is often utilized in various industrial applications, including the production of dyes, pigments, and pharmaceuticals due to its ability to undergo electrophilic substitution reactions. Anirolac may exhibit properties such as moderate solubility in organic solvents and potential reactivity with other chemical agents. Safety considerations are important when handling Anirolac, as many aromatic amines can be toxic or carcinogenic. Therefore, appropriate safety measures, including the use of personal protective equipment and proper ventilation, should be observed in any laboratory or industrial setting where this compound is used. As with all chemicals, it is essential to consult safety data sheets and relevant regulations to ensure safe handling and disposal.
Formula:C16H15NO4
InChI:InChI=1/C16H15NO4/c1-21-11-4-2-10(3-5-11)15(18)14-7-6-13-12(16(19)20)8-9-17(13)14/h2-7,12H,8-9H2,1H3,(H,19,20)
SMILES:COc1ccc(cc1)C(=O)c1ccc2C(CCn12)C(=O)O
Synonyms:- Anirolac [USAN:INN]
- (+-)-5-p-Anisoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid
- Anirolaco
- Anirolaco [Spanish]
- Anirolacum
- Anirolacum [Latin]
- Rs 37326
- Unii-S9B9E35Wux
- 1H-Pyrrolizine-1-carboxylic acid, 2,3-dihydro-5-(4-methoxybenzoyl)-, (+-)-
- 5-(4-methoxybenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid
