CAS 66642-36-2: N-(4-methyl-2-oxo-2H-chromen-7-yl)-5-oxo-L-prolinamide
Description:N-(4-methyl-2-oxo-2H-chromen-7-yl)-5-oxo-L-prolinamide, with the CAS number 66642-36-2, is a chemical compound that belongs to the class of chromenone derivatives. This substance features a chromenone moiety, which is characterized by a fused benzene and pyrone ring structure, contributing to its potential biological activity. The presence of the 5-oxo-L-prolinamide group indicates that it has an amide functional group linked to a proline derivative, which may influence its solubility and reactivity. The compound is likely to exhibit properties such as fluorescence due to the chromenone structure, and it may possess various pharmacological activities, including anti-inflammatory or antioxidant effects, although specific biological data would need to be referenced for confirmation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C15H14N2O4
InChI:InChI=1/C15H14N2O4/c1-8-6-14(19)21-12-7-9(2-3-10(8)12)16-15(20)11-4-5-13(18)17-11/h2-3,6-7,11H,4-5H2,1H3,(H,16,20)(H,17,18)/t11-/m0/s1
- Synonyms:
- L-Pyroglutamic Acid 4-Methyl-7-Coumarinylamide Hydrate
