CAS 66648-35-9

N-[(benzyloxy)carbonyl]glycyl-N-{(2S)-5-[(diaminomethylidene)amino]-2-[(4-nitrophenyl)amino]pentanoyl}-L-prolinamide

Description:

N-[(benzyloxy)carbonyl]glycyl-N-{(2S)-5-[(diaminomethylidene)amino]-2-[(4-nitrophenyl)amino]pentanoyl}-L-prolinamide, with CAS number 66648-35-9, is a complex organic compound characterized by its peptide-like structure. It features a benzyloxycarbonyl (Z) protecting group, which is commonly used in peptide synthesis to protect the amino group of glycine. The molecule also contains a prolinamide moiety, contributing to its potential biological activity. The presence of a 4-nitrophenyl group suggests that it may have applications in biochemical assays or as a substrate for enzyme reactions. Additionally, the diaminomethylidene group indicates potential interactions with biological targets, possibly influencing its pharmacological properties. This compound's intricate structure may allow for specific interactions in biological systems, making it of interest in medicinal chemistry and drug design. Overall, its unique combination of functional groups and structural features positions it as a candidate for further research in the fields of biochemistry and pharmacology.

Formula: C₂₇H₃₄N₈O₇

InChI: InChI=1/C27H34N8O7/c28-26(29)30-14-4-8-21(32-19-10-12-20(13-11-19)35(40)41)24(37)33-25(38)22-9-5-15-34(22)23(36)16-31-27(39)42-17-18-6-2-1-3-7-18/h1-3,6-7,10-13,21-22,32H,4-5,8-9,14-17H2,(H,31,39)(H4,28,29,30)(H,33,37,38)/t21-,22-/m0/s1

SMILES: c1ccc(cc1)COC(=NCC(=O)N1CCC[C@H]1C(=O)N=C([C@H](CCCNC(=N)N)Nc1ccc(cc1)N(=O)=O)O)O

Synonyms:

• Z-Gly-Pro-Arg-Pna

Z-Gly-Pro-Arg-pNA

CAS: 66648-35-9

Z-GPR-pNA, a chromogenic serine protease substrate. Kinetic data for Thrombin: kcat = 127, Km = 4.18.

Formula: C₂₇H₃₄N₈O₇

Purity: > 99%

Color and Shape: Whitish

Molecular weight: 582.62

Ref: 01-4000768

Z-Gly-Pro-Arg-pNA acetate

CAS: 66648-35-9

Z-Gly-Pro-Arg-pnaacetate is a substrate commonly used in enzyme research, particularly in the study of proteases. Proteases are enzymes responsible for catalyzing the hydrolysis of peptide bonds in proteins. In a study investigating the activation of protein C in blood plasma by a protease from Aspergillus ochraceus, the enzyme activity was qualitatively assessed using chromogenic peptide substrates, such as pGlu-Pro-Arg-pNA.

Formula: C₂₇H₃₄N₈O₇

Purity: Min. 95%

Molecular weight: 582.6 g/mol

Ref: 3D-RCA64835