CAS 66648-43-9
:N-trans-Feruloyltyramine
Description:
N-trans-Feruloyltyramine is a phenolic compound classified as a derivative of tyramine, which is an amino acid that plays a role in various biological processes. This compound is characterized by its structure, which features a feruloyl group attached to the amino acid tyramine. It is known for its potential antioxidant properties, which may contribute to various health benefits, including anti-inflammatory effects. N-trans-Feruloyltyramine is found in several plant species and is of interest in nutritional and pharmacological research due to its possible role in protecting cells from oxidative stress. Additionally, it may exhibit neuroprotective effects, making it a subject of study in the context of neurodegenerative diseases. The compound is typically analyzed using techniques such as chromatography and mass spectrometry to determine its concentration and purity in various samples. Overall, N-trans-Feruloyltyramine represents a significant area of interest in the field of natural products and medicinal chemistry.
Formula:C18H19NO4
InChI:InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+
InChI key:InChIKey=NPNNKDMSXVRADT-WEVVVXLNSA-N
SMILES:C(=C/C(NCCC1=CC=C(O)C=C1)=O)\C2=CC(OC)=C(O)C=C2
Synonyms:- Moupinamide
- N-trans-Feruloyltyramine
- 2-Propenamide, 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-, (E)-
- 2-Propenamide, 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-, (2E)-
- (2E)-3-(4-Hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-2-propenamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-trans-Feruloyltyramine
CAS:Formula:C18H19NO4Purity:99%Color and Shape:SolidMolecular weight:313.3478N-trans-Feruloyltyramine
CAS:NTF is hepatoprotective, antioxidant, inhibits COX, prevents platelet aggregation, and reduces melanin by downregulating tyrosinase.Formula:C18H19NO4Purity:98.36% - >99.99%Color and Shape:SolidMolecular weight:313.35Ref: TM-T3S0645
1mg70.00€5mg170.00€10mg283.00€25mg490.00€50mg700.00€100mg938.00€1mL*10mM (DMSO)120.00€N-trans-feruloyltyramine
CAS:Cyclic amideFormula:C18H19NO4Purity:≥ 90.0 % (HPLC)Molecular weight:313.35Moupinamide
CAS:Moupinamide is a novel amide compound that has shown efficacy in vitro and in vivo against neuronal death. It has been shown to inhibit the activation of the apoptosis pathway by inhibiting toll-like receptor 4 (TLR4) and activating the anti-inflammatory pathway. Moupinamide also inhibits the production of proinflammatory mediators, such as prostaglandins, cytokines, and nitric oxide, which are involved in inflammatory responses. The compound also inhibits the production of reactive oxygen species (ROS) and protects neurons from oxidative damage. Moupinamide has excellent chemical stability with no degradation over time at physiological pH or temperature. In addition, it can be metabolized by mammals without adverse effects on liver function and does not affect blood clotting times. Moupinamide is a sesquiterpene lactone that is structurally related to valproic acid found in valproate salts used for treatment of seizures and bipolar disorder.Formula:C18H19NO4Purity:Min. 95%Molecular weight:313.35 g/mol






