CAS 6665-16-3
:Serylleucine
Description:
Serylleucine, with the CAS number 6665-16-3, is an amino acid that is classified as a non-proteinogenic amino acid. It is characterized by its unique structure, which includes a side chain that contributes to its distinct properties compared to standard amino acids. Serylleucine is known for its potential role in various biochemical processes, although it is not commonly found in proteins. Its solubility in water and organic solvents can vary, influencing its behavior in biological systems. The substance may exhibit specific interactions with enzymes and receptors, making it of interest in biochemical research and potential therapeutic applications. Additionally, like many amino acids, serylleucine can participate in various metabolic pathways, contributing to the synthesis of proteins and other biomolecules. However, detailed studies on its biological functions and applications are still ongoing, and further research is necessary to fully understand its significance in biochemistry and pharmacology.
Formula:C9H18N2O4
InChI:InChI=1/C20H18F2N2/c21-17-5-9-19(10-6-17)23-13-15-1-2-16(4-3-15)14-24-20-11-7-18(22)8-12-20/h1-12,23-24H,13-14H2
InChI key:InChIKey=NFDYGNFETJVMSE-BQBZGAKWSA-N
SMILES:[C@H](NC([C@H](CO)N)=O)(CC(C)C)C(O)=O
Synonyms:- 1,4-benzenedimethanamine, N~1~,N~4~-bis(4-fluorophenyl)-
- 123: PN: US20130123467 SEQID: 148 claimed protein
- 190: PN: EP2161028 PAGE: 10 claimed protein
- 7: PN: US20090239809 SEQID: 7 claimed protein
- <span class="text-smallcaps">L</smallcap>-Leucine, <smallcap>L</span>-seryl-
- <span class="text-smallcaps">L</smallcap>-Leucine, N-<smallcap>L</span>-seryl-
- <span class="text-smallcaps">L</smallcap>-Seryl-<smallcap>L</span>-leucine
- Leucine, N-<span class="text-smallcaps">L</smallcap>-seryl-, <smallcap>L</span>-
- Leucine, N-<span class="text-smallcaps">L</span>-seryl-
- Serylleucine
- L-Leucine, L-seryl-
- Leucine, N-L-seryl-
- L-Seryl-L-leucine
- L-Leucine, N-L-seryl-
- Leucine, N-L-seryl-, L-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Ser-Leu-OH
CAS:Substrate for human kidney dipeptidase.Formula:C9H18N2O4Purity:> 99%Color and Shape:White PowderMolecular weight:218.25H-Ser-Leu-OH
CAS:H-Ser-Leu-OH is a methylvaleric acid that is found in biological tissue and has been studied for its potential use as a pharmacological treatment. It has been shown to have anti-inflammatory effects, which may be due to its inhibition of prostaglandin synthesis. H-Ser-Leu-OH also inhibits the activity of divalent metal ions, such as magnesium and zinc, by binding to their chelating groups. This binding prevents the formation of an enzyme cell wall synthesis complex with the enzyme that is required for cell wall biosynthesis, inhibiting protein synthesis and cell division. H-Ser-Leu-OH has also shown potential as an analytical method for cancer detection. It can be used to detect carcinogenesis by detecting changes in DNA methylation patterns at the promoter region of tumor suppressor genes (e.g., RASSF1A).Formula:C9H18N2O4Purity:Min. 95%Molecular weight:218.25 g/mol


