
CAS 6665-19-6
:L-Lysyl-L-serine
Description:
L-Lysyl-L-serine, with the CAS number 6665-19-6, is a dipeptide composed of the amino acids lysine and serine. It is characterized by its structure, which features a peptide bond linking the carboxyl group of serine to the amino group of lysine. This compound is typically found in a crystalline form and is soluble in water due to the presence of polar functional groups. L-Lysyl-L-serine plays a role in various biological processes, including protein synthesis and cellular signaling. It may also exhibit potential benefits in areas such as nutrition and biochemistry, particularly in the context of peptide-based therapies. The presence of lysine contributes to its basicity, while serine adds polar characteristics, influencing its interactions in biological systems. As a dipeptide, it can participate in various biochemical reactions and may serve as a building block for larger peptides or proteins. Overall, L-Lysyl-L-serine is of interest in both research and potential therapeutic applications due to its unique properties and biological significance.
Formula:C9H19N3O4
InChI:InChI=1S/C9H19N3O4/c10-4-2-1-3-6(11)8(14)12-7(5-13)9(15)16/h6-7,13H,1-5,10-11H2,(H,12,14)(H,15,16)/t6-,7-/m0/s1
InChI key:InChIKey=YSZNURNVYFUEHC-BQBZGAKWSA-N
SMILES:[C@@H](NC([C@H](CCCCN)N)=O)(C(O)=O)CO
Synonyms:- Serine, N-L-lysyl-, L-
- 106: PN: EP2161028 PAGE: 10 claimed protein
- L-Lysyl-L-serine
- L-Serine, N-L-lysyl-
- L-Serine, L-lysyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lysyl-serine
CAS:<p>Lysyl-serine is a bioactive chemical.</p>Formula:C9H19N3O4Color and Shape:SolidMolecular weight:233.26
