CAS 6665-67-4
:5,4′-Dihydroxyflavone
Description:
5,4′-Dihydroxyflavone, with the CAS number 6665-67-4, is a flavonoid compound characterized by its two hydroxyl groups located at the 5 and 4' positions of the flavone backbone. This compound exhibits a yellow to orange color, typical of many flavonoids, and is known for its antioxidant properties, which contribute to its potential health benefits. It is soluble in organic solvents and has limited solubility in water, which is common for flavonoids due to their polyphenolic structure. 5,4′-Dihydroxyflavone has been studied for its biological activities, including anti-inflammatory, anti-cancer, and neuroprotective effects. Additionally, it may play a role in modulating various signaling pathways in cells. Its presence in various plants suggests potential applications in herbal medicine and functional foods. As with many flavonoids, it is of interest in the field of nutraceuticals for its potential health-promoting properties.
Formula:C15H10O4
InChI:InChI=1/C15H10O4/c16-10-6-4-9(5-7-10)14-8-12(18)15-11(17)2-1-3-13(15)19-14/h1-8,16-17H
InChI key:InChIKey=OKRNDQLCMXUCGG-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC=C(O)C=C3)=CC=CC2O
Synonyms:- 4H-1-benzopyran-4-one, 5-hydroxy-2-(4-hydroxyphenyl)-
- 4′,5-Dihydroxyflavone
- 5,4′-Dihydroxyflavone
- 5-Hydroxy-2-(4-Hydroxyphenyl)chromen-4-one
- 5-Hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- 5-Hydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one
- Flavone, 4′,5-dihydroxy-
- 4',5-Dihydroxyflavone
- Lipoxygenase,Glucosidase,LOX,4',5-Dihydroxyflavone,4',5 Dihydroxyflavone,inhibit,Inhibitor,4',5Dihydroxyflavone
- 5-Hydroxy-2-(4-hydroxyphenyl)
- 5-Dihydroxyflavone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Hydroxy-2-(4-Hydroxyphenyl)-4H-Chromen-4-One
CAS:5-Hydroxy-2-(4-Hydroxyphenyl)-4H-Chromen-4-OnePurity:98%Molecular weight:254.24g/mol4',5-Dihydroxyflavone
CAS:Formula:C15H10O4Purity:95%~99%Color and Shape:Yellow powderMolecular weight:254.2414',5-Dihydroxyflavone
CAS:4',5-Dihydroxyflavone is a soybean LOX-1(Ki: 102.6 μM) and yeast α-Glucosidase inhibitor (IC50: 66 μM).Formula:C15H10O4Purity:99.81%Color and Shape:SolidMolecular weight:254.244',5-Dihydroxyflavone
CAS:4',5-Dihydroxyflavone is a naturally occurring flavone, which is a type of polyphenolic compound. It is derived from various plant sources, particularly those rich in flavonoids, such as certain fruits, vegetables, and herbal extracts. The compound's mode of action primarily involves its ability to act as an antioxidant, scavenging free radicals and reducing oxidative stress in biological systems. This antioxidant activity is often linked to neuroprotective properties, as it may help mitigate damage to neurons caused by oxidative stress.
Formula:C15H10O4Purity:Min. 98%Color and Shape:PowderMolecular weight:254.24 g/molRef: 3D-FD66316
Discontinued product





