CAS 6665-72-1

5-Hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one

Description:

5-Hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one, also known by its CAS number 6665-72-1, is a synthetic organic compound belonging to the class of flavonoids. This compound features a benzopyran core structure, which is characteristic of many flavonoids, and is substituted with a hydroxyl group and a methoxyphenyl group, contributing to its potential biological activity. It typically exhibits a yellow to orange color, which is common among flavonoids due to their conjugated double bond systems that allow for light absorption. The presence of the hydroxyl group enhances its solubility in polar solvents and may contribute to its antioxidant properties. This compound has been studied for various pharmacological activities, including anti-inflammatory and anticancer effects, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially influencing cellular pathways. As with many flavonoids, it may also exhibit UV-absorbing properties, which can be beneficial in applications such as photoprotection in cosmetic formulations.

Formula: C₁₆H₁₂O₄

InChI: InChI=1S/C16H12O4/c1-19-11-7-5-10(6-8-11)15-9-13(18)16-12(17)3-2-4-14(16)20-15/h2-9,17H,1H3

InChI key: InChIKey=WAGFUKCEIMCKQR-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC(=C1)C3=CC=C(OC)C=C3)=CC=CC2O

Synonyms:

• 5-Hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-methoxyphenyl)-
• NSC 123408
• Flavone, 5-hydroxy-4′-methoxy-

5-Hydroxy-4'-methoxyflavone

CAS: 6665-72-1

5-Hydroxy-4'-methoxyflavone is a naturally occurring flavone, which is a type of polyphenolic compound found in various plants. It is derived from natural sources such as fruits, vegetables, and certain herbs. This compound is part of the larger class of flavonoids, which are known for their various biological activities and potential health benefits.

Formula: C₁₆H₁₂O₄

Purity: Min. 95%

Molecular weight: 268.26 g/mol

Ref: 3D-XH183036