CAS 6665-75-4

5-Methoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one

Description:

5-Methoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one, also known by its CAS number 6665-75-4, is a synthetic organic compound belonging to the class of flavonoids. This compound features a benzopyran core structure, which is characterized by a fused benzene and pyran ring. Its molecular structure includes methoxy groups, which are known to enhance solubility and influence biological activity. The presence of these methoxy substituents can also affect the compound's electronic properties, potentially leading to antioxidant and anti-inflammatory activities. In terms of physical properties, it is typically a solid at room temperature, with a specific melting point and solubility profile that can vary based on the solvent used. The compound has garnered interest in medicinal chemistry for its potential therapeutic applications, particularly in the fields of cancer research and neuroprotection. As with many flavonoids, it may exhibit various biological activities, including anti-cancer, anti-viral, and anti-inflammatory effects, making it a subject of ongoing research in pharmacology and biochemistry.

Formula: C₁₇H₁₄O₄

InChI: InChI=1S/C17H14O4/c1-19-12-6-3-5-11(9-12)16-10-13(18)17-14(20-2)7-4-8-15(17)21-16/h3-10H,1-2H3

InChI key: InChIKey=HHAYKNGPBZOQMY-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(OC(=CC2=O)C3=CC(OC)=CC=C3)=CC=C1

Synonyms:

• 5-Methoxy-2-(3-methoxyphenyl)-4H-1-benzopyran-4-one
• Flavone, 3′,5-dimethoxy-
• 4H-1-Benzopyran-4-one, 5-methoxy-2-(3-methoxyphenyl)-

5,3'-Dimethoxyflavone

CAS: 6665-75-4

5,3'-Dimethoxyflavone is a flavone derivative, which is a compound within the larger class of flavonoids. These compounds are primarily sourced from various plant species, where they contribute to pigmentation, growth, and defense. The presence of methoxy groups in this molecule alters its chemical properties, enhancing its solubility and bioavailability, which are critical for biological activity.

Formula: C₁₇H₁₄O₄

Purity: Min. 95%

Molecular weight: 282.29 g/mol

Ref: 3D-XD183052