CAS 6665-83-4
:6-Hydroxyflavone
Description:
6-Hydroxyflavone is a flavonoid compound characterized by its hydroxyl group located at the sixth position of the flavone structure. It typically appears as a pale yellow to white crystalline solid and is soluble in organic solvents such as ethanol and methanol, but less soluble in water. This compound exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The presence of the hydroxyl group enhances its reactivity and ability to form hydrogen bonds, contributing to its biological efficacy. Additionally, 6-hydroxyflavone can participate in various chemical reactions, such as oxidation and complexation with metal ions. Its structural features allow it to interact with various biological targets, which is significant for its potential therapeutic applications. Overall, 6-hydroxyflavone is a versatile compound with notable chemical and biological properties that warrant further investigation in the fields of medicinal chemistry and natural product research.
Formula:C15H10O3
InChI:InChI=1S/C15H10O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-9,16H
InChI key:InChIKey=GPZYYYGYCRFPBU-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC=CC=C3)=CC=C(O)C2
Synonyms:- 4H-1-Benzopyran-4-one, 6-hydroxy-2-phenyl-
- 6-Flavonol
- 6-Hydroxy-2-phenyl-4H-1-benzopyran-4-one
- 6-Hydroxyflavone
- 6-hydroxy-2-phenyl-4H-chromen-4-one
- Flavone, 6-hydroxy-
- Nsc 26744
- 6-Hydroxy-2-phenyl-4-benzopyrone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
6-Hydroxyflavone
CAS:Formula:C15H10O3Purity:>98.0%(HPLC)Color and Shape:Light yellow to Yellow to Green powder to crystalMolecular weight:238.246-Hydroxyflavone, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C15H10O3Purity:98%Color and Shape:Pale yellow, Crystals or powder or crystalline powderMolecular weight:238.246-Hydroxyflavone
CAS:6-Hydroxyflavone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C15H10O3Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:238.256-Hydroxyflavone
CAS:6-Hydroxyflavone (6-HF) inhibits cytochrome P450 2C9, found in Barleria prionitis, and may treat anxiety disorders.Formula:C15H10O3Purity:99.73% - 99.93%Color and Shape:Light Yellow CrystalsMolecular weight:238.246-Hydroxyflavone
CAS:6-Hydroxyflavone is a flavonoid compound, which is a type of secondary metabolite derived from plants. It is commonly found in various plant species and is known for its diverse array of biological activities. The mode of action of 6-Hydroxyflavone involves its interaction with various enzymatic systems and receptors, including modulation of signaling pathways and antioxidant activity. This compound acts primarily through the inhibition of enzymes such as phosphodiesterases and by exhibiting potential neuroprotective effects through GABAergic and serotonergic systems.
Formula:C15H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:238.24 g/mol









