CAS 66663-90-9
:Platycodin D2
Description:
Platycodin D2 is a triterpenoid saponin derived from the root of Platycodon grandiflorum, commonly known as balloon flower. This compound is characterized by its complex structure, which includes a steroid-like backbone and multiple sugar moieties, contributing to its biological activity. Platycodin D2 exhibits various pharmacological properties, including anti-inflammatory, immunomodulatory, and anticancer effects, making it a subject of interest in medicinal chemistry and pharmacology. Its mechanism of action often involves the modulation of signaling pathways and the induction of apoptosis in cancer cells. Additionally, Platycodin D2 has been studied for its potential to enhance respiratory health and alleviate symptoms associated with respiratory conditions. The compound is typically extracted and purified from plant sources, and its stability and solubility can vary depending on the formulation. As research continues, Platycodin D2 may offer insights into new therapeutic applications and contribute to the development of natural product-based medicines.
Formula:C63H102O33
InChI:InChI=1S/C63H102O33/c1-24-44(91-50-42(80)45(29(71)19-85-50)92-55-48(82)62(84,22-68)23-87-55)39(77)41(79)51(88-24)94-47-35(73)28(70)18-86-54(47)96-56(83)63-12-11-57(2,3)13-26(63)25-7-8-32-58(4)14-27(69)49(61(20-66,21-67)33(58)9-10-59(32,5)60(25,6)15-34(63)72)95-53-43(81)46(37(75)31(17-65)90-53)93-52-40(78)38(76)36(74)30(16-64)89-52/h7,24,26-55,64-82,84H,8-23H2,1-6H3/t24-,26-,27-,28-,29+,30+,31+,32+,33+,34+,35-,36+,37+,38-,39-,40+,41+,42+,43+,44-,45-,46-,47+,48-,49-,50-,51-,52-,53-,54-,55-,58+,59+,60+,62+,63+/m0/s1
InChI key:PXQNZQURQNZGKZ-MXNHKPIDSA-N
SMILES:C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2OC(=O)[C@]34CCC(C[C@H]3C5=CC[C@H]6[C@]([C@@]5(C[C@H]4O)C)(CC[C@@H]7[C@@]6(C[C@@H]([C@@H](C7(CO)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)C)C)(C)C)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O[C@H]1[C@@H]([C@](CO1)(CO)O)O)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Platycodin D2
CAS:Platycodin D2 , a less hemolytic saponin, can improve specific cellular and humoral responses to hepatitis B surface antigen in mice, it could be safely used as adjuvant eliciting Th1 and Th2 immune responses. Polygalacin D2 has anti-cancer activity, it exhibits significant inhibition on the proliferation of five kinds of cultured human tumor cell lines.Formula:C63H102O33Purity:95%~99%Molecular weight:1387.48Platycodin D2
CAS:Platycodin D2 enhances immune response to Hep B in mice with minimal hemolysis, acting as a safe Th1/Th2 adjuvant.Formula:C63H102O33Purity:97.24% - 99.92%Color and Shape:White SolidMolecular weight:1387.46Ref: TM-TN2088
1mg50.00€5mg105.00€10mg167.00€1mL*10mM (DMSO)250.00€25mg268.00€50mg408.00€100mg587.00€Platycodin D2
CAS:Platycodin D2 is a bioactive saponin, which is a phytochemical compound found predominantly in the roots of Platycodon grandiflorus, a species commonly known as the Chinese bellflower. This compound is known for its surfactant properties due to its ability to form stable foams when dissolved in aqueous solutions. The mode of action of Platycodin D2 involves interaction with cell membranes, where it can disrupt lipid bilayers, leading to increased cell permeability. This property is crucial for its potential therapeutic effects, as it can facilitate the delivery of other pharmacologically active compounds across cellular barriers.Formula:C63H102O33Purity:Min. 95%Molecular weight:1,387.46 g/mol





