CAS 666728-39-8

5-(1-benzofuran-2-yl)-1H-pyrazole

Description:

5-(1-benzofuran-2-yl)-1H-pyrazole is an organic compound characterized by its unique structure, which includes a pyrazole ring fused with a benzofuran moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the benzofuran group may contribute to its ability to interact with various biological targets, potentially leading to applications in drug development. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the hydrophobic nature of its aromatic components. Its molecular structure suggests that it may participate in various chemical reactions, including electrophilic substitutions and coordination with metal ions. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrazole and benzofuran rings. Overall, 5-(1-benzofuran-2-yl)-1H-pyrazole represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation.

Formula: C₁₁H₈N₂O

InChI: InChI=1/C11H8N2O/c1-2-4-10-8(3-1)7-11(14-10)9-5-6-12-13-9/h1-7H,(H,12,13)

SMILES: c1ccc2c(c1)cc(c1cc[nH]n1)o2

Synonyms:

• 1H-pyrazole, 3-(2-benzofuranyl)-
• 3-(1-benzofuran-2-yl)-1H-pyrazole
• 3-(Benzo[b]furan-2-yl)-1H-pyrazole

3-(Benzo[b]furan-2-yl)-1H-pyrazole

CAS: 666728-39-8

3-(Benzo[b]furan-2-yl)-1H-pyrazole

Purity: ≥95%

Molecular weight: 184.19g/mol

Ref: 54-OR183462

3-(1-benzofuran-2-yl)-1H-pyrazole

CAS: 666728-39-8

Purity: 95.0%

Color and Shape: Solid, Beige powder

Molecular weight: 184.197998046875

Ref: 10-F310999