CAS 666734-51-6

4-bromo-6,7-dimethoxyquinoline

Description:

4-Bromo-6,7-dimethoxyquinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of bromine at the 4-position and two methoxy groups at the 6 and 7 positions contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the methoxy groups, which can enhance its polarity. It may also display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The bromine substituent can influence its reactivity and potential interactions with biological targets. As with many quinoline derivatives, it may also exhibit fluorescence properties, which can be useful in various analytical applications. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks.

Formula: C₁₁H₁₀BrNO₂

InChI: InChI=1/C11H10BrNO2/c1-14-10-5-7-8(12)3-4-13-9(7)6-11(10)15-2/h3-6H,1-2H3

SMILES: COc1cc2c(ccnc2cc1OC)Br

Synonyms:

• Quinoline, 4-Bromo-6,7-Dimethoxy-
• 4-Bromo-6,7-dimethoxyquinoline

4-Bromo-6,7-dimethoxyquinoline

CAS: 666734-51-6

Formula: C₁₁H₁₀BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 268.1066

Ref: IN-DA00FCHM

4-Bromo-6,7-dimethoxyquinoline

CAS: 666734-51-6

4-Bromo-6,7-dimethoxyquinoline

Purity: 98%

Molecular weight: 268.11g/mol

Ref: 54-OR903361

4-Bromo-6,7-dimethoxyquinoline

CAS: 666734-51-6

Formula: C₁₁H₁₀BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 268.11

Ref: 10-F076715