CAS 666747-06-4: 2,4-Dibromobenzenemethanol
Description:2,4-Dibromobenzenemethanol is an organic compound characterized by the presence of a benzene ring substituted with two bromine atoms at the 2 and 4 positions, along with a hydroxymethyl group (-CH2OH) attached to the benzene. This compound is part of the class of brominated aromatic alcohols, which can exhibit various chemical properties due to the influence of the bromine substituents. The bromine atoms can enhance the compound's reactivity, particularly in electrophilic substitution reactions, while the hydroxymethyl group can participate in hydrogen bonding, affecting its solubility and boiling point. Typically, compounds like 2,4-dibromobenzenemethanol may be used in organic synthesis, as intermediates in the production of pharmaceuticals, agrochemicals, or other functional materials. Safety considerations are important, as brominated compounds can pose environmental and health risks, necessitating careful handling and disposal. Overall, the unique structure of 2,4-dibromobenzenemethanol contributes to its potential applications in various chemical processes.
Formula:C7H6Br2O
InChI:InChI=1S/C7H6Br2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2
InChI key:InChIKey=VXEVXBMLHQPKGA-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C(Br)=C1)CO
- Synonyms:
- (2,4-Dibromophenyl)methanol
- 2,4-Dibromobenzenemethanol
- Benzenemethanol, 2,4-Dibromo-
- 2,4-Dibromobenzyl alcohol
