CAS 66675-73-8
:3,12-dihydroxyhexadecanoic acid
Description:
3,12-Dihydroxyhexadecanoic acid, also known as a specific type of hydroxy fatty acid, is characterized by the presence of two hydroxyl (-OH) groups located at the 3rd and 12th carbon positions of a 16-carbon straight-chain fatty acid. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water is limited due to its hydrophobic fatty acid chain. The presence of hydroxyl groups imparts unique properties, such as increased polarity and potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may exhibit biological activity, making it of interest in various fields, including biochemistry and materials science. Its derivatives can be utilized in the synthesis of surfactants, emulsifiers, and other functional materials. Additionally, the compound's structural features may contribute to its role in biological systems, potentially affecting lipid metabolism and cellular signaling pathways.
Formula:C16H32O4
InChI:InChI=1/C16H32O4/c1-2-3-10-14(17)11-8-6-4-5-7-9-12-15(18)13-16(19)20/h14-15,17-18H,2-13H2,1H3,(H,19,20)
SMILES:CCCCC(CCCCCCCCC(CC(=O)O)O)O
Synonyms:- Hexadecanoic Acid, 3,12-Dihydroxy-
- 3,12-Dihydroxyhexadecanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,12-Dihydroxyhexadecanoic Acid
CAS:Controlled ProductFormula:C16H32O4Color and Shape:NeatMolecular weight:288.423
