CAS 666826-27-3

Benzenamine, 4-[2-(1H-benzimidazol-2-yl)ethenyl]-N,N-diethyl-, 4-methylbenzenesulfonate (1:1)

Description:

Benzenamine, 4-[2-(1H-benzimidazol-2-yl)ethenyl]-N,N-diethyl-, 4-methylbenzenesulfonate (1:1), with CAS number 666826-27-3, is a chemical compound characterized by its complex structure, which includes a benzenamine core substituted with a benzimidazole moiety and a sulfonate group. This compound typically exhibits properties associated with both amines and sulfonates, such as potential solubility in polar solvents and the ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the benzimidazole group suggests potential biological activity, as benzimidazoles are known for their pharmacological properties. The diethyl substitution on the amine enhances its lipophilicity, which may influence its interaction with biological membranes. Additionally, the sulfonate group can enhance water solubility and may play a role in the compound's reactivity and stability. Overall, this compound's unique structure may lend itself to applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and characterization.

Formula: C₁₉H₂₁N₃·C₇H₈O₃S

InChI: InChI=1S/C19H21N3.C7H8O3S/c1-3-22(4-2)16-12-9-15(10-13-16)11-14-19-20-17-7-5-6-8-18(17)21-19;1-6-2-4-7(5-3-6)11(8,9)10/h5-14H,3-4H2,1-2H3,(H,20,21);2-5H,1H3,(H,8,9,10)

InChI key: InChIKey=CCCFPXPTFYRLGJ-UHFFFAOYSA-N

SMILES: C(=CC1=CC=C(N(CC)CC)C=C1)C=2NC=3C(N2)=CC=CC3.S(=O)(=O)(O)C1=CC=C(C)C=C1

Synonyms:

• Benzenamine, 4-[2-(1H-benzimidazol-2-yl)ethenyl]-N,N-diethyl-, 4-methylbenzenesulfonate (1:1)
• Benzenamine, 4-[2-(1H-benzimidazol-2-yl)ethenyl]-N,N-diethyl-, mono(4-methylbenzenesulfonate)
• BF 126

BF 126

CAS: 666826-27-3

BF 126 has potential applications in vivo imaging of tau pathology in Alzheimer's disease

Formula: C₂₆H₂₉N₃O₃S

Color and Shape: Solid

Molecular weight: 463.6

Ref: TM-T30437