CAS 666829-33-0
:Poly(oxy-1,2-ethanediyl), α-[3-(triethoxysilyl)propyl]-ω-[3-(triethoxysilyl)propoxy]-
Description:
Poly(oxy-1,2-ethanediyl), α-[3-(triethoxysilyl)propyl]-ω-[3-(triethoxysilyl)propoxy]- is a silane-based polymer characterized by its unique structure that combines polyether segments with triethoxysilyl groups. This compound typically exhibits properties such as good thermal stability, hydrophilicity, and the ability to form strong bonds with inorganic materials, making it useful in various applications, including surface modification, adhesion promotion, and as a coupling agent in composites. The presence of triethoxysilyl groups allows for effective bonding to silica and other silicate materials, enhancing the mechanical properties of composites. Additionally, the polymer's ether linkages contribute to its flexibility and compatibility with organic solvents. Its multifunctional nature enables it to serve in diverse fields, including coatings, sealants, and advanced materials. Overall, this compound is valued for its ability to improve the performance and durability of materials in both industrial and consumer applications.
Formula:(C2H4O)nC18H42O7Si2
InChI:InChI=1S/C20H46O8Si2/c1-7-23-29(24-8-2,25-9-3)19-13-15-21-17-18-22-16-14-20-30(26-10-4,27-11-5)28-12-6/h7-20H2,1-6H3
InChI key:InChIKey=AVVDFKYUIFAGEV-UHFFFAOYSA-N
SMILES:[Si](CCCOCCOCCC[Si](OCC)(OCC)OCC)(OCC)(OCC)OCC
Synonyms:- SIB 1824.84
- Poly(oxy-1,2-ethanediyl), α-[3-(triethoxysilyl)propyl]-ω-[3-(triethoxysilyl)propoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BIS(3-TRIETHOXYSILYLPROPYL)POLYETHYLENE OXIDE (25-30 EO)
CAS:<p>Dipodal PEG Silane (1,400-1,600 g/mol)<br>PEO, Triethoxysilane termination utilized for hydrophilic surface modificationDual functional PEGylation reagentHydrogen bonding hydrophilic silaneHydrolytically stable hydrophilic silane<br></p>Formula:CH3O(C2H4O)6-9(CH2)3Si(OCH3)3Color and Shape:Off-White SolidMolecular weight:1400-1600
