CAS 66684-57-9

1,2,5-Trifluoro-3-nitrobenzene

Description:

1,2,5-Trifluoro-3-nitrobenzene is an aromatic compound characterized by the presence of three fluorine atoms and a nitro group attached to a benzene ring. The molecular structure features a nitro group (-NO2) positioned at the meta position relative to the trifluoromethyl groups (-CF3) on the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits significant polarity due to the electronegative fluorine and nitro substituents, which can influence its reactivity and solubility in various solvents. The presence of fluorine atoms enhances its chemical stability and can impart unique properties, such as increased lipophilicity and altered electronic characteristics. 1,2,5-Trifluoro-3-nitrobenzene is used in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks due to its potential toxicity and environmental impact.

Formula: C₆H₂F₃NO₂

InChI: InChI=1S/C6H2F3NO2/c7-3-1-4(8)6(9)5(2-3)10(11)12/h1-2H

InChI key: InChIKey=MXOQPGDHOAMPJW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(F)C(F)=CC(F)=C1

Synonyms:

• 2,3,5-Trifluoronitrobenzene
• Benzene, 1,2,5-trifluoro-3-nitro-
• 1,2,5-Trifluoro-3-nitrobenzene

1,2,5-Trifluoro-3-nitrobenzene

CAS: 66684-57-9

Formula: C₆H₂F₃NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 177.0808

Ref: IN-DA006ISE

2,3,5-Trifluoronitrobenzene

CAS: 66684-57-9

2,3,5-Trifluoronitrobenzene

Formula: C₆H₂F₃NO₂

Purity: 97%

Color and Shape: brown liquid

Molecular weight: 177.08g/mol

Ref: 54-PC502429

1,2,5-Trifluoro-3-nitrobenzene

CAS: 66684-57-9

Formula: C₆H₂F₃NO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 177.082

Ref: 10-F209727