CAS 66684-59-1

2,3-Difluoro-1-methoxy-4-nitrobenzene

Description:

2,3-Difluoro-1-methoxy-4-nitrobenzene is an organic compound characterized by the presence of two fluorine atoms, a methoxy group, and a nitro group attached to a benzene ring. The fluorine substituents are located at the 2 and 3 positions, while the methoxy group is at the 1 position and the nitro group at the 4 position, contributing to its overall reactivity and polarity. This compound is typically a pale yellow solid or liquid, depending on its purity and specific conditions. It exhibits moderate solubility in organic solvents due to the presence of the methoxy group, which enhances its polar characteristics. The nitro group introduces significant electron-withdrawing properties, influencing the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of fluorine atoms can enhance the compound's stability and alter its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chemical nature.

Formula: C₇H₅F₂NO₃

InChI: InChI=1S/C7H5F2NO3/c1-13-5-3-2-4(10(11)12)6(8)7(5)9/h2-3H,1H3

InChI key: InChIKey=KDXIYOKCZFOFOR-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(F)C(F)=C(OC)C=C1

Synonyms:

• 2,3-Difluoro-1-Methoxy-4-Nitrobenzene
• 2,3-Difluoro-4-methoxynitrobenzene
• Benzene, 2,3-difluoro-1-methoxy-4-nitro-

2,3-Difluoro-4-nitroanisole

CAS: 66684-59-1

Formula: C₇H₅F₂NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 189.1163

Ref: IN-DA006ISD

2,3-Difluoro-4-nitroanisole

CAS: 66684-59-1

2,3-Difluoro-4-nitroanisole

Purity: 98%

Color and Shape: White To Yellow Powder

Molecular weight: 189.12g/mol

Ref: 54-PC2555

2,3-Difluoro-4-nitroanisole

CAS: 66684-59-1

2,3-Difluoro-4-nitroanisole is a chemical compound with CAS No. 66684-59-1. It is a useful intermediate that can be used to synthesize other chemicals and compounds. 2,3-Difluoro-4-nitroanisole can be used for the synthesis of research chemicals and speciality chemicals. This compound has been found to be a versatile building block that can be used in many reactions as a reagent. 2,3-Difluoro-4-nitroanisole has high quality and is a fine chemical with many uses.

Formula: C₇H₅F₂NO₃

Purity: Min. 95%

Molecular weight: 189.12 g/mol

Ref: 3D-FD70068

2,3-Difluoro-4-nitroanisole

CAS: 66684-59-1

Formula: C₇H₅F₂NO₃

Purity: 98%

Molecular weight: 189.118

Ref: 10-F092680