CAS 66684-60-4

1,2-Difluoro-3-methoxy-4-nitrobenzene

Description:

1,2-Difluoro-3-methoxy-4-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms, a methoxy group, and a nitro group. The presence of the difluoro substituents indicates that the compound exhibits enhanced reactivity and potential for various chemical transformations. The methoxy group (-OCH3) contributes to the compound's electron-donating properties, while the nitro group (-NO2) is a strong electron-withdrawing group, influencing the compound's overall electronic properties and reactivity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific interactions of the substituents. Additionally, the compound's fluorine atoms may impart unique characteristics, such as increased lipophilicity and stability against metabolic degradation, making it of interest in medicinal chemistry and materials science.

Formula: C₇H₅F₂NO₃

InChI: InChI=1S/C7H5F2NO3/c1-13-7-5(10(11)12)3-2-4(8)6(7)9/h2-3H,1H3

InChI key: InChIKey=BCWRUHXLSHZAEA-UHFFFAOYSA-N

SMILES: O(C)C1=C(N(=O)=O)C=CC(F)=C1F

Synonyms:

• 1,2-Difluoro-3-methoxy-4-nitrobenzene
• Benzene,1,2-difluoro-3-methoxy-4-nitro-
• 1,2-Difluoro-3-(methyloxy)-4-nitrobenzene

1,2-Difluoro-3-methoxy-4-nitrobenzene

CAS: 66684-60-4

Formula: C₇H₅F₂NO₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 189.1163

Ref: IN-DA003FIH

2,3-Difluoro-6-nitroanisole

CAS: 66684-60-4

2,3-Difluoro-6-nitroanisole

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 189.12g/mol

Ref: 54-PC11218

2,3-Difluoro-6-nitroanisole

CAS: 66684-60-4

2,3-Difluoro-6-nitroanisole is a chemical that can be used as a building block for the synthesis of other compounds. It is a versatile intermediate that is useful in the synthesis of a wide variety of compounds. 2,3-Difluoro-6-nitroanisole has been used in research and as a reagent in organic chemistry. The compound has been observed to have high quality and to be stable under most conditions. CAS No. 66684-60-4 is assigned to 2,3-difluoro-6 nitroanisole in the Chemical Abstracts Service registry system.

Formula: C₇H₅F₂NO₃

Purity: Min. 95%

Molecular weight: 189.12 g/mol

Ref: 3D-FD70353

2,3-Difluoro-6-nitroanisole

CAS: 66684-60-4

Formula: C₇H₅F₂NO₃

Purity: 98%

Color and Shape: Liquid

Molecular weight: 189.118

Ref: 10-F038279