CAS 66684-64-8

benzene, 1,2-difluoro-4-methoxy-5-nitro-

Description:

Benzene, 1,2-difluoro-4-methoxy-5-nitro- is an aromatic compound characterized by a benzene ring substituted with two fluorine atoms, a methoxy group, and a nitro group. The presence of the difluoro substituents indicates that fluorine atoms are attached to the first and second carbon atoms of the benzene ring, while the methoxy group (-OCH3) is located at the fourth position and the nitro group (-NO2) at the fifth position. This compound exhibits typical properties of aromatic compounds, including stability due to resonance. The presence of electronegative substituents like fluorine and nitro groups can significantly influence its reactivity, making it more electrophilic. The methoxy group, being an electron-donating group, can also affect the overall electron density of the ring. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique electronic properties and potential applications in synthesis. Safety data should be consulted, as nitro compounds can be hazardous.

Formula: C₇H₅F₂NO₃

InChI: InChI=1/C7H5F2NO3/c1-13-7-3-5(9)4(8)2-6(7)10(11)12/h2-3H,1H3

SMILES: COc1cc(c(cc1N(=O)=O)F)F

Synonyms:

• 1,2-Difluoro-4-methoxy-5-nitrobenzene
• 4,5-Difluoro-2-nitrophenyl methyl ether

1,2-Difluoro-4-methoxy-5-nitrobenzene

CAS: 66684-64-8

Formula: C₇H₅F₂NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 189.1163

Ref: IN-DA006ISB

1,2-Difluoro-4-methoxy-5-nitrobenzene

CAS: 66684-64-8

1,2-Difluoro-4-methoxy-5-nitrobenzene

Purity: 98%

Color and Shape: Solid

Molecular weight: 189.12g/mol

Ref: 54-PC909902

1,2-Difluoro-4-methoxy-5-nitrobenzene

CAS: 66684-64-8

Purity: 98%

Molecular weight: 189.1179962

Ref: 10-F637888