CAS 66698-28-0
:1-(4-Bromophenyl)piperazine
Description:
1-(4-Bromophenyl)piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a bromophenyl group at the 1-position of the piperazine ring significantly influences its chemical properties and biological activity. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits basic properties due to the nitrogen atoms in the piperazine ring, allowing it to form salts with acids. 1-(4-Bromophenyl)piperazine is of interest in medicinal chemistry, particularly for its potential pharmacological effects, including activity as a serotonin receptor modulator. Its structure allows for various substitutions, which can lead to a diverse range of derivatives with differing biological activities. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound serves as a valuable scaffold in drug discovery and development.
Formula:C10H13BrN2
InChI:InChI=1/C10H13BrN2/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13/h1-4,12H,5-8H2
SMILES:c1cc(ccc1Br)N1CCNCC1
Synonyms:- Piperazine, 1-(4-bromophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(4-Bromophenyl)piperazine
CAS:Formula:C10H13BrN2Purity:98%Color and Shape:SolidMolecular weight:241.12761-(4-Bromophenyl)piperazine
CAS:Controlled Product1-(4-Bromophenyl)piperazine is a chemical that is used in the synthesis of pharmaceuticals, such as antidepressants. It has been shown to inhibit monoamine neurotransmitter reuptake, including serotonin and dopamine. It also has an inhibitory effect on 5-hydroxytryptamine (5HT) release from nerve terminals and its binding to the 5HT7 receptor. 1-(4-Bromophenyl)piperazine can be used in chromatographic methods for validation of impurities, potential impurities, and other substances.
Formula:C10H13BrN2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:241.13 g/mol


