CAS 667-24-3
:4-(methylsulfonyl)benzenesulfonamide
Description:
4-(Methylsulfonyl)benzenesulfonamide, also known by its CAS number 667-24-3, is an organic compound characterized by the presence of both sulfonamide and methylsulfonyl functional groups attached to a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its sulfonamide groups which enhance its polarity. The presence of the methylsulfonyl group contributes to its potential as a sulfonamide derivative, which may exhibit biological activity, including antimicrobial properties. The compound's structure allows for hydrogen bonding, which can influence its reactivity and interactions with biological targets. Additionally, it may be used in various chemical syntheses and research applications, particularly in medicinal chemistry. Safety data indicates that, like many sulfonamides, it should be handled with care due to potential allergic reactions in sensitive individuals. Overall, 4-(methylsulfonyl)benzenesulfonamide is a versatile compound with applications in both research and pharmaceutical contexts.
Formula:C7H9NO4S2
InChI:InChI=1/C7H9NO4S2/c1-13(9,10)6-2-4-7(5-3-6)14(8,11)12/h2-5H,1H3,(H2,8,11,12)
SMILES:CS(=O)(=O)c1ccc(cc1)S(=O)(=O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Methanesulfonylbenzene-1-sulfonamide
CAS:<p>4-Methanesulfonylbenzene-1-sulfonamide is a research chemical that is used in assays to study the metabolism of penicillium chrysogenum and other fungi. The metabolite 4-methanesulfonylbenzenesulfonic acid has been shown to inhibit fungal growth by inhibiting the synthesis of proteins, such as ribosomal proteins, which are necessary for cell division. This research chemical has also been shown to inhibit the production of aflatoxins, which are carcinogenic compounds produced by Aspergillus flavus and other species of fungi. 4-Methanesulfonylbenzene-1-sulfonamide has been found to be safe for use in humans and animals and can be used as a replacement for methyl bromide due to its sustainable functionality.</p>Formula:C7H9NO4S2Purity:Min. 95%Molecular weight:235.3 g/mol
