CAS 6672-30-6
:(+)-3-Methylcyclopentanone
Description:
(+)-3-Methylcyclopentanone is a cyclic ketone characterized by its five-membered ring structure containing a carbonyl group (C=O) and a methyl substituent at the third carbon position. This compound is a colorless liquid with a distinctive odor, often described as sweet or floral, which makes it of interest in the fragrance and flavor industries. Its molecular formula is C6H10O, and it has a relatively low boiling point, typical of small organic molecules. The presence of the carbonyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic addition and condensation. Additionally, (+)-3-Methylcyclopentanone exhibits chirality, with the (+) designation indicating its specific optical activity. This property can influence its interactions in biological systems, making it relevant in studies of stereochemistry and pharmacology. Overall, this compound is notable for its unique structural features and potential applications in organic synthesis and industrial processes.
Formula:C6H10O
InChI:InChI=1S/C6H10O/c1-5-2-3-6(7)4-5/h5H,2-4H2,1H3/t5-/m1/s1
InChI key:InChIKey=AOKRXIIIYJGNNU-RXMQYKEDSA-N
SMILES:C[C@H]1CC(=O)CC1
Synonyms:- (+)-3-Methylcyclopentanone
- (3R)-3-Methylcyclopentan-1-one
- (3R)-3-Methylcyclopentanone
- Cyclopentanone, 3-methyl-, (+)-
- Cyclopentanone, 3-methyl-, (3R)-
- Cyclopentanone, 3-methyl-, (R)-
- R-(+)-3-Methylcyclopentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(R)-(+)-3-Methylcyclopentanone
CAS:Controlled Product<p>Applications (R)-(+)-3-Methylcyclopentanone (cas# 6672-30-6) is a useful research chemical.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C6H10OColor and Shape:NeatMolecular weight:98.14
