CAS 66734-95-0
:4-Isobutylcinnamic acid
Description:
4-Isobutylcinnamic acid is an organic compound characterized by its structure, which features a cinnamic acid backbone with an isobutyl group attached to the para position of the phenyl ring. This compound typically appears as a solid at room temperature and is known for its potential applications in the fields of organic synthesis and materials science. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The presence of the isobutyl group contributes to its hydrophobic characteristics and may influence its reactivity and interaction with other molecules. Additionally, 4-Isobutylcinnamic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its melting point and boiling point can vary based on purity and environmental conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 4-Isobutylcinnamic acid is a compound of interest due to its unique structural features and potential applications.
Formula:C13H16O2
InChI:InChI=1/C13H16O2/c1-10(2)9-12-5-3-11(4-6-12)7-8-13(14)15/h3-8,10H,9H2,1-2H3,(H,14,15)/b8-7+
Synonyms:- 3-(4-Isobutylphenyl)acrylic acid
- (E)-3-(4-isobutylphenyl)prop-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Isobutylcinnamic acid
CAS:4-Isobutylcinnamic acidFormula:C13H16O2Purity:≥95%Color and Shape:SolidMolecular weight:204.26g/mol4-Isobutylcinnamic acid
CAS:4-Isobutylcinnamic acid is an organic compound that is a derivative of the organic compound acrylic acid. It is an organic ester, which means it is formed by the reaction of an alcohol and an acid. Acrylic acid can be reacted with either ethyl alcohol or isobutyl alcohol to produce 4-isobutylcinnamic acid. The resulting product can be used in the production of polymers and plastics.Formula:C13H16O2Purity:Min. 95%Color and Shape:PowderMolecular weight:204.26 g/mol


