CAS 6674-39-1

5-hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one

Description:

5-Hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one, also known as flavonol, is a chemical compound belonging to the flavonoid class, characterized by its chromenone structure. This compound features a chromone backbone with hydroxyl groups at the 5 and 2 positions, contributing to its antioxidant properties. It is typically found in various plants and is known for its potential health benefits, including anti-inflammatory and antimicrobial activities. The presence of multiple hydroxyl groups enhances its solubility in polar solvents and increases its reactivity, making it a subject of interest in pharmacological research. Additionally, this compound may exhibit fluorescence, which can be utilized in analytical applications. Its molecular structure allows for various interactions with biological systems, making it a valuable compound in the study of natural products and their therapeutic potentials. Overall, 5-hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one is significant in both natural product chemistry and medicinal chemistry due to its diverse biological activities.

Formula: C₁₅H₁₀O₄

InChI: InChI=1/C15H10O4/c16-10-5-2-1-4-9(10)14-8-12(18)15-11(17)6-3-7-13(15)19-14/h1-8,16-17H

SMILES: c1ccc(c(c1)c1cc(=O)c2c(cccc2o1)O)O

Synonyms:

• 2',5-Dihydroxyflavone
• 4H-1-benzopyran-4-one, 5-hydroxy-2-(2-hydroxyphenyl)-
• 6674-39-1
• 5-Hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one

5,2'-Dihydroxyflavone

CAS: 6674-39-1

5,2'-Dihydroxyflavone is a type of flavonoid, which is a class of polyphenolic compounds. These compounds are predominantly found in various plants, serving as part of their secondary metabolites. As a natural phytochemical, 5,2'-Dihydroxyflavone has garnered attention for its potential bioactive properties, particularly in the realm of neuroprotection.

Formula: C₁₅H₁₀O₄

Purity: Min. 95%

Molecular weight: 254.24 g/mol

Ref: 3D-FD66330