CymitQuimica logo

CAS 667403-46-5

:

N-[(2,5-dichlorophenyl)carbonyl]glycine

Description:
N-[(2,5-dichlorophenyl)carbonyl]glycine, with the CAS number 667403-46-5, is a chemical compound characterized by its structure, which includes a glycine moiety linked to a 2,5-dichlorophenyl carbonyl group. This compound typically exhibits properties associated with both amino acids and aromatic compounds, including potential solubility in polar solvents due to the presence of the amino group. The dichlorophenyl group may impart specific biological activity or reactivity, making it of interest in pharmaceutical or agrochemical research. The carbonyl functionality suggests that it may participate in various chemical reactions, such as acylation or condensation. Additionally, the presence of chlorine atoms can influence the compound's electronic properties and stability. Overall, N-[(2,5-dichlorophenyl)carbonyl]glycine is a compound that may be studied for its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C9H7Cl2NO3
InChI:InChI=1/C9H7Cl2NO3/c10-5-1-2-7(11)6(3-5)9(15)12-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14)
InChI key:HKUAUZSWGMQPOK-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Cl)C(=NCC(=O)O)O)Cl
Found 7 products.