CAS 66741-82-0

N-Butyl-4-(phenylmethoxy)benzenemethanamine

Description:

N-Butyl-4-(phenylmethoxy)benzenemethanamine, with the CAS number 66741-82-0, is an organic compound characterized by its complex structure, which includes a butyl group, a phenylmethoxy moiety, and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the butyl group contributes to its hydrophobic characteristics, while the phenylmethoxy group may enhance its stability and reactivity. N-Butyl-4-(phenylmethoxy)benzenemethanamine may be utilized in various applications, including pharmaceuticals and organic synthesis, due to its potential biological activity and ability to interact with biological systems. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.

Formula: C₁₈H₂₃NO

InChI: InChI=1S/C18H23NO/c1-2-3-13-19-14-16-9-11-18(12-10-16)20-15-17-7-5-4-6-8-17/h4-12,19H,2-3,13-15H2,1H3

InChI key: InChIKey=UVMPEGCJOQKNDA-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=CC=C(CNCCCC)C=C2

Synonyms:

• N-[4-(Benzyloxy)benzyl]-N-butylamine
• Benzenemethanamine, N-butyl-4-(phenylmethoxy)-
• [[4-(Benzyloxy)phenyl]methyl](butyl)amine
• N-Butyl-4-(phenylmethoxy)benzenemethanamine

{[4-(benzyloxy)phenyl]methyl}(butyl)amine

CAS: 66741-82-0

Formula: C₁₈H₂₃NO

Purity: 95.0%

Molecular weight: 269.388

Ref: 10-F523116