CAS 667412-54-6
:2-Amino-6-ethyl-4,5,6,7-tetrahydro-N-(4-methylphenyl)benzo[b]thiophene-3-carboxamide
Description:
2-Amino-6-ethyl-4,5,6,7-tetrahydro-N-(4-methylphenyl)benzo[b]thiophene-3-carboxamide, with the CAS number 667412-54-6, is a synthetic organic compound characterized by its complex structure, which includes a benzo[b]thiophene core. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of an ethyl group and a 4-methylphenyl substituent enhances its lipophilicity, which may influence its pharmacokinetic properties. The tetrahydro configuration indicates that the compound contains a saturated ring system, which can affect its reactivity and interactions with biological targets. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development. The specific arrangement of functional groups and the overall molecular architecture suggest that it may exhibit interesting biological activities, although detailed studies would be necessary to elucidate its mechanisms of action and efficacy.
Formula:C18H22N2OS
InChI:InChI=1S/C18H22N2OS/c1-3-12-6-9-14-15(10-12)22-17(19)16(14)18(21)20-13-7-4-11(2)5-8-13/h4-5,7-8,12H,3,6,9-10,19H2,1-2H3,(H,20,21)
InChI key:InChIKey=HLABAHFROUWLSN-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C)C=C1)(=O)C=2C3=C(SC2N)CC(CC)CC3
Synonyms:- 2-Amino-6-ethyl-4,5,6,7-tetrahydro-N-(4-methylphenyl)benzo[b]thiophene-3-carboxamide
- Benzo[b]thiophene-3-carboxamide, 2-amino-6-ethyl-4,5,6,7-tetrahydro-N-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.