CAS 667412-78-4

5-cyclopropyl-4-(tetrahydrofuran-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-Cyclopropyl-4-(tetrahydrofuran-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structural features, including a triazole ring and a thione functional group. The presence of the cyclopropyl group contributes to its rigidity and may influence its reactivity and biological activity. The tetrahydrofuran moiety introduces an ether-like character, which can enhance solubility in organic solvents and may affect the compound's interaction with biological targets. This compound is likely to exhibit properties typical of thiones, such as potential antimicrobial or antifungal activity, due to the presence of the sulfur atom in the thione group. Additionally, the triazole ring is known for its role in various pharmacological applications, including as a scaffold in drug design. Overall, the combination of these structural elements suggests that this compound may have interesting chemical and biological properties, making it a candidate for further research in medicinal chemistry and related fields.

Formula: C₁₀H₁₅N₃OS

InChI: InChI=1/C10H15N3OS/c15-10-12-11-9(7-3-4-7)13(10)6-8-2-1-5-14-8/h7-8H,1-6H2,(H,12,15)

SMILES: C1CC(Cn2c(C3CC3)nnc2S)OC1

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-cyclopropyl-4-[(tetrahydro-2-furanyl)methyl]-

5-cyclopropyl-4-(tetrahydrofuran-2-ylmethyl)-4H-1,2,4-triazole-3-thiol

CAS: 667412-78-4

Formula: C₁₀H₁₅N₃OS

Purity: 95.0%

Molecular weight: 225.31

Ref: 10-F307467