CAS 667412-80-8

5-Cyclopentyl-2,4-dihydro-4-(2-propen-1-yl)-3H-1,2,4-triazole-3-thione

Description:

5-Cyclopentyl-2,4-dihydro-4-(2-propen-1-yl)-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a cyclopentyl group and an allyl substituent, contributing to its unique properties and potential reactivity. The presence of the thione functional group (–C=S) indicates that it may exhibit distinct chemical behavior compared to its oxo analogs, particularly in terms of reactivity and stability. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its molecular structure suggests that it could interact with biological systems, possibly influencing enzyme activity or serving as a scaffold for drug development. As with many triazole derivatives, it may also exhibit antifungal or herbicidal properties, making it a candidate for further research in medicinal chemistry and agricultural applications. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₀H₁₅N₃S

InChI: InChI=1S/C10H15N3S/c1-2-7-13-9(11-12-10(13)14)8-5-3-4-6-8/h2,8H,1,3-7H2,(H,12,14)

InChI key: InChIKey=CTVLUILOPVRQHJ-UHFFFAOYSA-N

SMILES: C(C=C)N1C(=NNC1=S)C2CCCC2

Synonyms:

• 3H-1,2,4-Triazole-3-thione, 5-cyclopentyl-2,4-dihydro-4-(2-propen-1-yl)-
• 3H-1,2,4-Triazole-3-thione, 5-cyclopentyl-2,4-dihydro-4-(2-propenyl)-
• 4-Allyl-5-cyclopentyl-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 5-cyclopentyl-4-(2-propen-1-yl)-
• 5-Cyclopentyl-2,4-dihydro-4-(2-propen-1-yl)-3H-1,2,4-triazole-3-thione

4-allyl-5-cyclopentyl-4H-1,2,4-triazole-3-thiol

CAS: 667412-80-8

Formula: C₁₀H₁₅N₃S

Purity: 95.0%

Molecular weight: 209.31

Ref: 10-F307736