CAS 667413-03-8

5-[1-(3,5-dimethylphenoxy)ethyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(3,5-dimethylphenoxy)ethyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 667413-03-8, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the triazole framework. The compound also contains an ethyl group and a phenoxyethyl substituent, which contribute to its lipophilicity and potential biological activity. Its structural complexity suggests that it may exhibit interesting pharmacological properties, possibly acting as a fungicide or herbicide, although specific biological activities would require empirical investigation. The presence of the dimethylphenyl group may enhance its interaction with biological targets. As with many triazole derivatives, it may also exhibit stability under various conditions, making it suitable for agricultural applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.

Formula: C₁₄H₁₉N₃OS

InChI: InChI=1/C14H19N3OS/c1-5-17-13(15-16-14(17)19)11(4)18-12-7-9(2)6-10(3)8-12/h6-8,11H,5H2,1-4H3,(H,16,19)

SMILES: CCn1c(C(C)Oc2cc(C)cc(C)c2)nnc1S

5-[1-(3,5-dimethylphenoxy)ethyl]-4-ethyl-4H-1,2,4-triazole-3-thiol

CAS: 667413-03-8

Formula: C₁₄H₁₉N₃OS

Purity: 95.0%

Molecular weight: 277.39

Ref: 10-F307804