CAS 667413-37-8

5-[(3,5-dimethylphenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(3,5-Dimethylphenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocycle containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of the 3,5-dimethylphenoxy group suggests that it may exhibit hydrophobic characteristics, which can influence its solubility and interaction with biological membranes. The methyl groups on the phenyl ring can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Additionally, the triazole moiety is known for its role in various biological applications, including antifungal and antimicrobial activities. Overall, this compound's unique structural features may confer specific properties that could be explored in medicinal chemistry and agricultural applications.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1/C12H15N3OS/c1-8-4-9(2)6-10(5-8)16-7-11-13-14-12(17)15(11)3/h4-6H,7H2,1-3H3,(H,14,17)

SMILES: Cc1cc(C)cc(c1)OCc1nnc(n1C)S

5-[(3,5-Dimethylphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 667413-37-8

Formula: C₁₂H₁₅N₃OS

Molecular weight: 249.3320

Ref: IN-DA00FANS

5-[(3,5-dimethylphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 667413-37-8

Formula: C₁₂H₁₅N₃OS

Purity: 95.0%

Molecular weight: 249.33

Ref: 10-F307760