CAS 667413-64-1

4-methyl-5-{1-[4-(1-methylethyl)phenoxy]ethyl}-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-methyl-5-{1-[4-(1-methylethyl)phenoxy]ethyl}-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its complex structure, which includes a triazole ring and a thione functional group. This compound features a methyl group and a phenoxyethyl substituent, contributing to its unique properties. It is typically classified as a thiazolidine derivative, which may exhibit biological activity, potentially making it of interest in pharmaceutical research. The presence of the triazole moiety suggests possible applications in agriculture or medicine, particularly as a fungicide or herbicide, due to the triazole's known role in inhibiting fungal sterol synthesis. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. Safety and handling precautions are essential, as with any chemical, to mitigate risks associated with exposure. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in various fields.

Formula: C₁₄H₁₉N₃OS

InChI: InChI=1/C14H19N3OS/c1-9(2)11-5-7-12(8-6-11)18-10(3)13-15-16-14(19)17(13)4/h5-10H,1-4H3,(H,16,19)

SMILES: CC(C)c1ccc(cc1)OC(C)c1nnc(n1C)S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-methyl-5-[1-[4-(1-methylethyl)phenoxy]ethyl]-
• 5-[1-(4-Isopropylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

5-[1-(4-isopropylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 667413-64-1

Formula: C₁₄H₁₉N₃OS

Purity: 95.0%

Molecular weight: 277.39

Ref: 10-F307813