CAS 667413-82-3

5-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 667413-82-3, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the 2,3-dimethylphenoxyethyl substituent suggests that it may exhibit hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The methyl groups on the triazole ring can also affect its steric properties and electronic distribution. This compound may be of interest in pharmaceutical research, particularly for its potential applications in agriculture or medicine, given the biological significance of triazole derivatives. Its specific properties, such as melting point, solubility, and reactivity, would need to be determined through experimental methods for practical applications.

Formula: C₁₃H₁₇N₃OS

InChI: InChI=1/C13H17N3OS/c1-8-6-5-7-11(9(8)2)17-10(3)12-14-15-13(18)16(12)4/h5-7,10H,1-4H3,(H,15,18)

5-[1-(2,3-Dimethylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 667413-82-3

Formula: C₁₃H₁₇N₃OS

Molecular weight: 263.3586

Ref: IN-DA00FAN5

5-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 667413-82-3

Formula: C₁₃H₁₇N₃OS

Purity: 95.0%

Molecular weight: 263.36

Ref: 10-F307806