CAS 667414-13-3

5-[(2-chloro-4-fluorophenoxy)methyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(2-chloro-4-fluorophenoxy)methyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 667414-13-3, is a chemical compound characterized by its complex structure, which includes a triazole ring and a thione functional group. This compound features a phenoxy group substituted with chlorine and fluorine, contributing to its potential biological activity. The presence of the prop-2-en-1-yl group indicates that it has unsaturation, which may enhance its reactivity. The triazole moiety is known for its role in various pharmacological applications, including antifungal and antimicrobial properties. Additionally, the thione group can participate in various chemical reactions, potentially influencing the compound's stability and reactivity. Overall, this compound may exhibit interesting properties that could be explored in medicinal chemistry and agricultural applications, although specific biological activities and applications would require further investigation and validation through experimental studies.

Formula: C₁₂H₁₁ClFN₃OS

InChI: InChI=1/C12H11ClFN3OS/c1-2-5-17-11(15-16-12(17)19)7-18-10-4-3-8(14)6-9(10)13/h2-4,6H,1,5,7H2,(H,16,19)

SMILES: C=CCn1c(COc2ccc(cc2Cl)F)nnc1S

4-allyl-5-[(2-chloro-4-fluorophenoxy)methyl]-4H-1,2,4-triazole-3-thiol

CAS: 667414-13-3

Formula: C₁₂H₁₁ClFN₃OS

Purity: 95.0%

Molecular weight: 299.75

Ref: 10-F307782