CAS 667414-17-7

5-[1-(3-chlorophenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(3-Chlorophenoxy)ethyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of a 3-chlorophenoxyethyl group suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. The methyl group on the triazole ring can affect the compound's lipophilicity and solubility. Overall, this compound may possess interesting properties for applications in pharmaceuticals or agrochemicals, although specific biological activities and mechanisms would require further investigation. Its CAS number, 667414-17-7, allows for easy identification and reference in chemical databases.

Formula: C₁₁H₁₂ClN₃OS

InChI: InChI=1/C11H12ClN3OS/c1-7(10-13-14-11(17)15(10)2)16-9-5-3-4-8(12)6-9/h3-7H,1-2H3,(H,14,17)

SMILES: CC(c1nnc(n1C)S)Oc1cccc(c1)Cl

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[1-(3-chlorophenoxy)ethyl]-4-methyl-

5-[1-(3-chlorophenoxy)ethyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 667414-17-7

Formula: C₁₁H₁₂ClN₃OS

Purity: 95.0%

Molecular weight: 269.75

Ref: 10-F307720