CAS 667414-42-8

5-[1-(2-methylphenoxy)ethyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[1-(2-methylphenoxy)ethyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 667414-42-8, is a chemical compound characterized by its triazole core, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the 2-methylphenoxyethyl and prop-2-en-1-yl substituents suggests that it may exhibit unique properties, including potential applications in agrochemicals or pharmaceuticals. The structural complexity of this compound may influence its solubility, stability, and interaction with biological systems. Additionally, the triazole moiety is known for its role in various biological activities, including antifungal and herbicidal properties. Overall, this compound's characteristics make it a subject of interest for further research in medicinal and agricultural chemistry.

Formula: C₁₄H₁₇N₃OS

InChI: InChI=1/C14H17N3OS/c1-4-9-17-13(15-16-14(17)19)11(3)18-12-8-6-5-7-10(12)2/h4-8,11H,1,9H2,2-3H3,(H,16,19)

SMILES: C=CCn1c(C(C)Oc2ccccc2C)nnc1S

4-allyl-5-[1-(2-methylphenoxy)ethyl]-4H-1,2,4-triazole-3-thiol

CAS: 667414-42-8

Formula: C₁₄H₁₇N₃OS

Purity: 95.0%

Molecular weight: 275.37

Ref: 10-F307793