CAS 667414-47-3

4-ethyl-5-{[4-(propan-2-yl)phenoxy]methyl}-4H-1,2,4-triazole-3-thiol

Description:

4-Ethyl-5-{[4-(propan-2-yl)phenoxy]methyl}-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a thiol group (-SH) that contributes to its reactivity and potential biological activity. The presence of an ethyl group and a propan-2-ylphenoxy moiety indicates that it has a relatively complex structure, which may influence its solubility and interaction with biological systems. The compound is likely to exhibit properties typical of triazoles, such as antifungal or antimicrobial activity, due to the presence of the triazole and thiol functionalities. Its specific applications may vary, but compounds of this nature are often explored in pharmaceutical research for their potential therapeutic effects. Additionally, the presence of the phenoxy group may enhance its lipophilicity, affecting its bioavailability and distribution in biological systems. Overall, this compound represents a unique structure with potential implications in medicinal chemistry.

Formula: C₁₄H₁₉N₃OS

InChI: InChI=1/C14H19N3OS/c1-4-17-13(15-16-14(17)19)9-18-12-7-5-11(6-8-12)10(2)3/h5-8,10H,4,9H2,1-3H3,(H,16,19)

SMILES: CCn1c(COc2ccc(cc2)C(C)C)nnc1S

Synonyms:

• 4-Ethyl-5-[(4-isopropylphenoxy)methyl]-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 4-ethyl-5-[[4-(1-methylethyl)phenoxy]methyl]-

4-ethyl-5-[(4-isopropylphenoxy)methyl]-4H-1,2,4-triazole-3-thiol

CAS: 667414-47-3

Formula: C₁₄H₁₉N₃OS

Purity: 95.0%

Molecular weight: 277.39

Ref: 10-F307770