CAS 667435-85-0

4-ethyl-5-(thiophen-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Ethyl-5-(thiophen-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic ring containing three nitrogen atoms. This compound features an ethyl group and a thiophenylmethyl substituent, contributing to its unique properties. The presence of the thione functional group (–C=S) indicates that it has potential reactivity typical of thioketones, which can participate in various chemical reactions, including nucleophilic attacks. The compound's structure suggests it may exhibit biological activity, making it of interest in medicinal chemistry and agricultural applications. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Additionally, the presence of the thiophene moiety may impart electronic properties that can influence its interactions with other molecules. Overall, this compound represents a class of triazole derivatives that are often explored for their potential pharmacological and agrochemical applications.

Formula: C₉H₁₁N₃S₂

InChI: InChI=1/C9H11N3S2/c1-2-12-8(10-11-9(12)13)6-7-4-3-5-14-7/h3-5H,2,6H2,1H3,(H,11,13)

SMILES: CCn1c(Cc2cccs2)nnc1S

Synonyms:

• 4-Ethyl-5-(2-thienylmethyl)-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 4-ethyl-5-(2-thienylmethyl)-

4-ethyl-5-(2-thienylmethyl)-4H-1,2,4-triazole-3-thiol

CAS: 667435-85-0

Formula: C₉H₁₁N₃S₂

Purity: 95.0%

Molecular weight: 225.33

Ref: 10-F307700