CAS 667436-00-2

Ethyl 2-[(2-cyanoacetyl)amino]-3-thiophenecarboxylate

Description:

Ethyl 2-[(2-cyanoacetyl)amino]-3-thiophenecarboxylate, identified by its CAS number 667436-00-2, is a chemical compound that features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound is characterized by the presence of an ethyl ester functional group, a cyanoacetyl moiety, and an amino group, contributing to its potential reactivity and biological activity. The thiophene ring imparts unique electronic properties, making it useful in various applications, including pharmaceuticals and agrochemicals. The cyanoacetyl group enhances the compound's ability to participate in nucleophilic reactions, while the amino group can engage in hydrogen bonding and other interactions. Overall, this compound's structural features suggest it may exhibit interesting chemical behavior and potential utility in synthetic organic chemistry or medicinal chemistry, although specific applications would depend on further research and characterization.

Formula: C₁₀H₁₀N₂O₃S

InChI: InChI=1S/C10H10N2O3S/c1-2-15-10(14)7-4-6-16-9(7)12-8(13)3-5-11/h4,6H,2-3H2,1H3,(H,12,13)

InChI key: InChIKey=WHMKXHGIDZJVHA-UHFFFAOYSA-N

SMILES: N(C(CC#N)=O)C1=C(C(OCC)=O)C=CS1

Synonyms:

• 3-Thiophenecarboxylic acid, 2-[(2-cyanoacetyl)amino]-, ethyl ester
• 3-Thiophenecarboxylic acid, 2-[(cyanoacetyl)amino]-, ethyl ester
• Ethyl 2-[(2-cyanoacetyl)amino]-3-thiophenecarboxylate