CAS 667436-25-1

5-(5-methylthiophen-3-yl)-4-propyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(5-methylthiophen-3-yl)-4-propyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structure, which includes a triazole ring and a thiophenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the thione functional group suggests it may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Additionally, the methylthio and propyl substituents can influence its lipophilicity and reactivity, potentially affecting its interaction with biological targets. The compound's molecular structure may also confer specific pharmacological properties, which could be explored in drug development. Overall, this substance represents a class of heterocyclic compounds that are often investigated for their potential applications in medicinal chemistry and agrochemicals.

Formula: C₁₀H₁₃N₃S₂

InChI: InChI=1/C10H13N3S2/c1-3-4-13-9(11-12-10(13)14)8-5-7(2)15-6-8/h5-6H,3-4H2,1-2H3,(H,12,14)

SMILES: CCCn1c(c2cc(C)sc2)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-(5-methyl-3-thienyl)-4-propyl-
• 5-(5-Methyl-3-thienyl)-4-propyl-4H-1,2,4-triazole-3-thiol

5-(5-methyl-3-thienyl)-4-propyl-4H-1,2,4-triazole-3-thiol

CAS: 667436-25-1

Formula: C₁₀H₁₃N₃S₂

Purity: 95.0%

Molecular weight: 239.36

Ref: 10-F307680