CAS 667436-66-0

5-Chloro-2-[(2-chloro-4-fluorophenyl)methoxy]benzaldehyde

Description:

5-Chloro-2-[(2-chloro-4-fluorophenyl)methoxy]benzaldehyde is an organic compound characterized by its complex aromatic structure, which includes a benzaldehyde functional group and multiple halogen substituents. The presence of chlorine and fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential reactivity in electrophilic aromatic substitution reactions. This compound typically exhibits a moderate to high melting point and is likely to be soluble in organic solvents due to its aromatic nature. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated compounds often exhibit enhanced biological activity. Additionally, the methoxy group can influence the compound's electronic properties, affecting its reactivity and interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Chloro-2-[(2-chloro-4-fluorophenyl)methoxy]benzaldehyde is a significant compound in the field of organic synthesis and drug development.

Formula: C₁₄H₉Cl₂FO₂

InChI: InChI=1S/C14H9Cl2FO2/c15-11-2-4-14(10(5-11)7-18)19-8-9-1-3-12(17)6-13(9)16/h1-7H,8H2

InChI key: InChIKey=XJQHWDOSHSABAA-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=C(F)C=C1)C2=C(C=O)C=C(Cl)C=C2

Synonyms:

• 5-Chloro-2-[(2-chloro-4-fluorophenyl)methoxy]benzaldehyde
• Benzaldehyde, 5-Chloro-2-[(2-Chloro-4-Fluorophenyl)Methoxy]-

5-chloro-2-[(2-chloro-4-fluorobenzyl)oxy]benzaldehyde

CAS: 667436-66-0

Formula: C₁₄H₉Cl₂FO₂

Purity: 95.0%

Molecular weight: 299.12

Ref: 10-F307570