CAS 667437-08-3

5-[(4-fluorophenoxy)methyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(4-Fluorophenoxy)methyl]-4-prop-2-en-1-yl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique structural features, including a triazole ring and a thione functional group. The presence of a fluorophenoxy group enhances its potential for biological activity, possibly influencing its solubility and reactivity. This compound is likely to exhibit properties typical of triazoles, such as potential antifungal or antimicrobial activity, due to the triazole moiety's ability to interact with biological targets. The alkenyl group (prop-2-en-1-yl) may contribute to its reactivity, allowing for further chemical modifications or interactions. Additionally, the thione group can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Overall, this compound's characteristics suggest it may have applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₂H₁₂FN₃OS

InChI: InChI=1/C12H12FN3OS/c1-2-7-16-11(14-15-12(16)18)8-17-10-5-3-9(13)4-6-10/h2-6H,1,7-8H2,(H,15,18)

SMILES: C=CCn1c(COc2ccc(cc2)F)nnc1S

4-allyl-5-[(4-fluorophenoxy)methyl]-4H-1,2,4-triazole-3-thiol

CAS: 667437-08-3

Formula: C₁₂H₁₂FN₃OS

Purity: 95.0%

Molecular weight: 265.31

Ref: 10-F307780