CAS 667437-40-3

4-methyl-5-[(3-methylphenoxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Methyl-5-[(3-methylphenoxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of the 3-methylphenoxy group suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. The methyl groups in the structure can enhance lipophilicity, potentially affecting its pharmacokinetics. This compound may be of interest in agricultural chemistry or medicinal chemistry due to its structural features, which could impart specific biological activities, such as antifungal or antibacterial properties. As with many triazole derivatives, it may also serve as a scaffold for further chemical modifications aimed at optimizing its efficacy and safety profiles in various applications.

Formula: C₁₁H₁₃N₃OS

InChI: InChI=1/C11H13N3OS/c1-8-4-3-5-9(6-8)15-7-10-12-13-11(16)14(10)2/h3-6H,7H2,1-2H3,(H,13,16)

SMILES: Cc1cccc(c1)OCc1nnc(n1C)S

4-methyl-5-[(3-methylphenoxy)methyl]-4H-1,2,4-triazole-3-thiol

CAS: 667437-40-3

Formula: C₁₁H₁₃N₃OS

Purity: 90.0%

Molecular weight: 235.31

Ref: 10-F307753