CAS 667437-94-7

5-[(4-tert-butylphenoxy)methyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(4-tert-butylphenoxy)methyl]-4-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole core, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The tert-butylphenoxy group enhances its lipophilicity, potentially improving its ability to penetrate biological membranes. The ethyl substituent adds to the compound's steric bulk and may influence its interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and agricultural applications. Its specific characteristics, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, the unique structural features of this compound suggest potential utility in various chemical and biological contexts.

Formula: C₁₅H₂₁N₃OS

InChI: InChI=1/C15H21N3OS/c1-5-18-13(16-17-14(18)20)10-19-12-8-6-11(7-9-12)15(2,3)4/h6-9H,5,10H2,1-4H3,(H,17,20)

SMILES: CCn1c(COc2ccc(cc2)C(C)(C)C)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[[4-(1,1-dimethylethyl)phenoxy]methyl]-4-ethyl-

5-[(4-tert-Butylphenoxy)methyl]-4-ethyl-4H-1,2,4-triazole-3-thiol

CAS: 667437-94-7

Formula: C₁₅H₂₁N₃OS

Molecular weight: 291.4117

Ref: IN-DA00FBTW

5-[(4-tert-butylphenoxy)methyl]-4-ethyl-4H-1,2,4-triazole-3-thiol

CAS: 667437-94-7

Formula: C₁₅H₂₁N₃OS

Purity: 95.0%

Molecular weight: 291.41

Ref: 10-F307773