CAS 66756-57-8
:Diosbulbin D
Description:
Diosbulbin D is a natural compound classified as a sesquiterpene lactone, primarily derived from the plant Dioscorea bulbifera, commonly known as air potato. This compound exhibits a range of biological activities, including anti-inflammatory, anti-cancer, and antimicrobial properties, making it of interest in pharmacological research. Diosbulbin D is characterized by its unique chemical structure, which includes a lactone ring and multiple chiral centers, contributing to its biological activity. The compound is typically studied for its potential therapeutic applications, particularly in traditional medicine systems. Its mechanism of action often involves modulation of various signaling pathways, which can influence cell proliferation and apoptosis. Additionally, Diosbulbin D's solubility and stability in different solvents can vary, impacting its bioavailability and efficacy in biological systems. As research continues, the exploration of Diosbulbin D's full potential in medicinal chemistry remains a promising area of study.
Formula:C19H20O6
InChI:InChI=1S/C19H20O6/c1-19-7-15(9-2-3-23-8-9)25-18(22)13(19)6-14(20)16-11-4-10(5-12(16)19)24-17(11)21/h2-3,8,10-13,15-16H,4-7H2,1H3
InChI key:InChIKey=FJCWYLRNGKSUCH-UHFFFAOYSA-N
SMILES:CC12C3C(C4CC(C3)OC4=O)C(=O)CC1C(=O)OC(C2)C=5C=COC5
Synonyms:- (2S,4aS,6aS,7R,10R,11aR,11bS)-2-(3-Furanyl)octahydro-11b-methyl-7,10-methano-2H-pyrano[4,3-g][3]benzoxepin-4,6,8(1H)-trione
- 7,10-Methano-2H-pyrano[4,3-g][3]benzoxepin-4,6,8(1H)-trione, 2-(3-furanyl)octahydro-11b-methyl-, (2S,4aS,6aS,7R,10R,11aR,11bS)-
- 7,10-Methano-2H-pyrano[4,3-g][3]benzoxepin-4,6,8(1H)-trione, 2-(3-furanyl)octahydro-11b-methyl-, [2S-(2α,4aβ,6aα,7α,10α,11aβ,11bα)]-
- Diosbulbin D
- NSC 310637
- Neodiosbulbin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2S)-2β-(3-Furyl)-4aα,5,6aβ,7,10,11,11aα,11b-octahydro-11bβ-methyl-7β,10β-methano-2H-pyrano[4,3-g][3]benzoxepine-4,6,8(1H)-trione
CAS:Formula:C19H20O6Purity:96.0%Molecular weight:344.3585Diosbulbin D
CAS:Diosbulbin D shows direct toxic effect on hepatocytes, the mechanism could be associated with oxidative stress.Formula:C19H20O6Purity:98%Color and Shape:SolidMolecular weight:344.363Diosbulbin D
CAS:<p>Diosbulbin D is a sesquiterpenoid lactone, which is a type of secondary metabolite found in plants. It is derived primarily from the Dioscorea bulbifera, also known as the air potato or bitter yam. The compound is known for its complex mechanism of action, which includes the induction of apoptosis through the activation of caspases and disruption of mitochondrial membrane potential, leading to cancer cell death.</p>Formula:C19H20O6Purity:Min. 95%Molecular weight:344.4 g/mol



