CAS 66766-07-2
:1-Amino-3-(3,5-dimethylphenoxy)-2-propanol
Description:
1-Amino-3-(3,5-dimethylphenoxy)-2-propanol, with the CAS number 66766-07-2, is an organic compound characterized by the presence of an amino group, a propanol backbone, and a phenoxy group derived from 3,5-dimethylphenol. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents like water and alcohols, which is attributed to the hydroxyl group in its structure. The presence of the amino group suggests potential basicity and reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the 3,5-dimethylphenoxy moiety may impart hydrophobic characteristics, influencing its interaction with biological systems and its potential applications in pharmaceuticals or agrochemicals. Safety data indicates that, like many amines, it should be handled with care due to possible irritant effects. Overall, this compound's unique structure allows for diverse applications in chemical synthesis and research.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c1-8-3-9(2)5-11(4-8)14-7-10(13)6-12/h3-5,10,13H,6-7,12H2,1-2H3
InChI key:InChIKey=OLZWOGIOHDAKHD-UHFFFAOYSA-N
SMILES:O(CC(CN)O)C1=CC(C)=CC(C)=C1
Synonyms:- 1-Amino-3-(3,5-dimethylphenoxy)-2-propanol
- 2-Propanol, 1-Amino-3-(3,5-Dimethylphenoxy)-
- 3-(3,5-Dimethylphenoxy)-2-hydroxypropylamine
- 1-Amino-3-(3,5-dimethylphenoxy)propan-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Metaxalone Related Compound B (1-amino-3-(3,5-dimethylphenoxy)propan-2-ol)
CAS:Aromatic monoamines not elsewhere specified or included and their derivatives, salts therofFormula:C11H17NO2Color and Shape:White PowderMolecular weight:195.12593


